C25H30N5O7P — CID 141235607
butyl 4-[(2R)-2-[[6-(2-hydroxyethoxy)-2-phenylpyrimidine-4-carbonyl]amino]-3-(oxo-λ5-phosphanylidyne)propanoyl]piperazine-1-carboxylate (PubChem CID 141235607) has the molecular formula C25H30N5O7P and a molecular weight of 543.52 g/mol. Its IUPAC name is butyl 4-[(2R)-2-[[6-(2-hydroxyethoxy)-2-phenylpyrimidine-4-carbonyl]amino]-3-(oxo-λ5-phosphanylidyne)propanoyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[(2R)-2-[[6-(2-hydroxyethoxy)-2-phenylpyrimidine-4-carbonyl]amino]-3-(oxo-λ5-phosphanylidyne)propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141235607 |
| Molecular Formula | C25H30N5O7P |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | butyl 4-[(2R)-2-[[6-(2-hydroxyethoxy)-2-phenylpyrimidine-4-carbonyl]amino]-3-(oxo-λ5-phosphanylidyne)propanoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)[C@H](C#P=O)NC(=O)c2cc(OCCO)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C25H30N5O7P/c1-2-3-14-37-25(34)30-11-9-29(10-12-30)24(33)20(17-38-35)27-23(32)19-16-21(36-15-13-31)28-22(26-19)18-7-5-4-6-8-18/h4-8,16,20,31H,2-3,9-15H2,1H3,(H,27,32)/t20-/m0/s1 |
| InChIKey | AIUKCODORUISAT-FQEVSTJZSA-N |
| XLogP | 1.94 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|