C26H35N6O7P — CID 174618689
5-[4-[(2R)-2-[[6-(cyclopropylamino)-2-phenylpyrimidine-4-carbonyl]amino]-3-phosphonopropanoyl]piperazin-1-yl]pentanoic acid (PubChem CID 174618689) has the molecular formula C26H35N6O7P and a molecular weight of 574.58 g/mol. Its IUPAC name is 5-[4-[(2R)-2-[[6-(cyclopropylamino)-2-phenylpyrimidine-4-carbonyl]amino]-3-phosphonopropanoyl]piperazin-1-yl]pentanoic acid.
| Compound Name | 5-[4-[(2R)-2-[[6-(cyclopropylamino)-2-phenylpyrimidine-4-carbonyl]amino]-3-phosphonopropanoyl]piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 174618689 |
| Molecular Formula | C26H35N6O7P |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 5-[4-[(2R)-2-[[6-(cyclopropylamino)-2-phenylpyrimidine-4-carbonyl]amino]-3-phosphonopropanoyl]piperazin-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCN1CCN(C(=O)[C@H](CP(=O)(O)O)NC(=O)c2cc(NC3CC3)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C26H35N6O7P/c33-23(34)8-4-5-11-31-12-14-32(15-13-31)26(36)21(17-40(37,38)39)29-25(35)20-16-22(27-19-9-10-19)30-24(28-20)18-6-2-1-3-7-18/h1-3,6-7,16,19,21H,4-5,8-15,17H2,(H,29,35)(H,33,34)(H,27,28,30)(H2,37,38,39)/t21-/m0/s1 |
| InChIKey | XLUQSAINWQMIQY-NRFANRHFSA-N |
| XLogP | 1.39 |
| TPSA | 185.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|