C28H37N4O8P — CID 174615550
5-[4-[(2R)-2-[[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]-6-phenylpyridine-2-carbonyl]amino]-3-phosphonopropanoyl]piperazin-1-yl]pentanoic acid (PubChem CID 174615550) has the molecular formula C28H37N4O8P and a molecular weight of 588.60 g/mol. Its IUPAC name is 5-[4-[(2R)-2-[[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]-6-phenylpyridine-2-carbonyl]amino]-3-phosphonopropanoyl]piperazin-1-yl]pentanoic acid.
| Compound Name | 5-[4-[(2R)-2-[[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]-6-phenylpyridine-2-carbonyl]amino]-3-phosphonopropanoyl]piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 174615550 |
| Molecular Formula | C28H37N4O8P |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 5-[4-[(2R)-2-[[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]-6-phenylpyridine-2-carbonyl]amino]-3-phosphonopropanoyl]piperazin-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCN1CCN(C(=O)[C@H](CP(=O)(O)O)NC(=O)c2cc([C@H]3C[C@@H]3CO)cc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C28H37N4O8P/c33-17-21-14-22(21)20-15-23(19-6-2-1-3-7-19)29-24(16-20)27(36)30-25(18-41(38,39)40)28(37)32-12-10-31(11-13-32)9-5-4-8-26(34)35/h1-3,6-7,15-16,21-22,25,33H,4-5,8-14,17-18H2,(H,30,36)(H,34,35)(H2,38,39,40)/t21-,22-,25+/m1/s1 |
| InChIKey | ZWVZNIYSLOCQPJ-RQTOMXEWSA-N |
| XLogP | 1.52 |
| TPSA | 180.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|