C38H46N4O7 — CID 175263554
tert-butyl 4-[(2S)-3-[4-(2-formyloxyethyl)piperazin-1-yl]-2-[[4-[2-(methoxymethyl)cyclopropyl]-6-phenylpyridine-2-carbonyl]amino]-3-oxopropyl]benzoate (PubChem CID 175263554) has the molecular formula C38H46N4O7 and a molecular weight of 670.81 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-3-[4-(2-formyloxyethyl)piperazin-1-yl]-2-[[4-[2-(methoxymethyl)cyclopropyl]-6-phenylpyridine-2-carbonyl]amino]-3-oxopropyl]benzoate.
| Compound Name | tert-butyl 4-[(2S)-3-[4-(2-formyloxyethyl)piperazin-1-yl]-2-[[4-[2-(methoxymethyl)cyclopropyl]-6-phenylpyridine-2-carbonyl]amino]-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 175263554 |
| Molecular Formula | C38H46N4O7 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | tert-butyl 4-[(2S)-3-[4-(2-formyloxyethyl)piperazin-1-yl]-2-[[4-[2-(methoxymethyl)cyclopropyl]-6-phenylpyridine-2-carbonyl]amino]-3-oxopropyl]benzoate |
| SMILES | COCC1CC1c1cc(C(=O)N[C@@H](Cc2ccc(C(=O)OC(C)(C)C)cc2)C(=O)N2CCN(CCOC=O)CC2)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C38H46N4O7/c1-38(2,3)49-37(46)28-12-10-26(11-13-28)20-34(36(45)42-16-14-41(15-17-42)18-19-48-25-43)40-35(44)33-23-29(31-21-30(31)24-47-4)22-32(39-33)27-8-6-5-7-9-27/h5-13,22-23,25,30-31,34H,14-21,24H2,1-4H3,(H,40,44)/t30?,31?,34-/m0/s1 |
| InChIKey | VLTDGJYVQBHCIA-SLXWVAMBSA-N |
| XLogP | 4.11 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|