C11H23O4P — CID 88542564
propan-2-yl 3-dimethylphosphoryloxy-2,2-dimethylbutanoate (PubChem CID 88542564) has the molecular formula C11H23O4P and a molecular weight of 250.27 g/mol. Its IUPAC name is propan-2-yl 3-dimethylphosphoryloxy-2,2-dimethylbutanoate.
| Compound Name | propan-2-yl 3-dimethylphosphoryloxy-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 88542564 |
| Molecular Formula | C11H23O4P |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | propan-2-yl 3-dimethylphosphoryloxy-2,2-dimethylbutanoate |
| SMILES | CC(C)OC(=O)C(C)(C)C(C)OP(C)(C)=O |
| InChI | InChI=1S/C11H23O4P/c1-8(2)14-10(12)11(4,5)9(3)15-16(6,7)13/h8-9H,1-7H3 |
| InChIKey | HWHRKTMGKSZHBY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|