C12H16N4O2 — CID 88544612
2-[(E)-3-ethylperoxyprop-1-enyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 88544612) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-[(E)-3-ethylperoxyprop-1-enyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[(E)-3-ethylperoxyprop-1-enyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 88544612 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-[(E)-3-ethylperoxyprop-1-enyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCOOC/C=C/c1nc2nc(C)cc(C)n2n1 |
| InChI | InChI=1S/C12H16N4O2/c1-4-17-18-7-5-6-11-14-12-13-9(2)8-10(3)16(12)15-11/h5-6,8H,4,7H2,1-3H3/b6-5+ |
| InChIKey | RHXNVUUSWVECFZ-AATRIKPKSA-N |
| XLogP | 1.72 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|