C12H14N6OS2 — CID 52729567
2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-5-ethoxy-1,3,4-thiadiazole (PubChem CID 52729567) has the molecular formula C12H14N6OS2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-5-ethoxy-1,3,4-thiadiazole.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-5-ethoxy-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 52729567 |
| Molecular Formula | C12H14N6OS2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-5-ethoxy-1,3,4-thiadiazole |
| SMILES | CCOc1nnc(CSc2nc3nc(C)cc(C)n3n2)s1 |
| InChI | InChI=1S/C12H14N6OS2/c1-4-19-12-16-15-9(21-12)6-20-11-14-10-13-7(2)5-8(3)18(10)17-11/h5H,4,6H2,1-3H3 |
| InChIKey | RAXRUBXWSVOWMP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |