C14H18N6OS2 — CID 1018090
2-[(2R)-butan-2-yl]sulfanyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-oxadiazole (PubChem CID 1018090) has the molecular formula C14H18N6OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-[(2R)-butan-2-yl]sulfanyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-oxadiazole.
| Compound Name | 2-[(2R)-butan-2-yl]sulfanyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 1018090 |
| Molecular Formula | C14H18N6OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-[(2R)-butan-2-yl]sulfanyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-oxadiazole |
| SMILES | CC[C@@H](C)Sc1nnc(CSc2nc3nc(C)cc(C)n3n2)o1 |
| InChI | InChI=1S/C14H18N6OS2/c1-5-10(4)23-14-18-17-11(21-14)7-22-13-16-12-15-8(2)6-9(3)20(12)19-13/h6,10H,5,7H2,1-4H3/t10-/m1/s1 |
| InChIKey | DUFQFSBXUIXVDE-SNVBAGLBSA-N |
| XLogP | 3.31 |
| TPSA | 82.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |