C40H78N4O4 — CID 88545293
1-N,2-N,3-N,4-N-tetrakis(2,4-dimethylhexyl)butane-1,2,3,4-tetracarboxamide (PubChem CID 88545293) has the molecular formula C40H78N4O4 and a molecular weight of 679.09 g/mol. Its IUPAC name is 1-N,2-N,3-N,4-N-tetrakis(2,4-dimethylhexyl)butane-1,2,3,4-tetracarboxamide.
| Compound Name | 1-N,2-N,3-N,4-N-tetrakis(2,4-dimethylhexyl)butane-1,2,3,4-tetracarboxamide |
|---|---|
| PubChem CID | 88545293 |
| Molecular Formula | C40H78N4O4 |
| Molecular Weight | 679.09 g/mol |
| Exact Mass | 678.60 |
| IUPAC Name | 1-N,2-N,3-N,4-N-tetrakis(2,4-dimethylhexyl)butane-1,2,3,4-tetracarboxamide |
| SMILES | CCC(C)CC(C)CNC(=O)CC(C(=O)NCC(C)CC(C)CC)C(CC(=O)NCC(C)CC(C)CC)C(=O)NCC(C)CC(C)CC |
| InChI | InChI=1S/C40H78N4O4/c1-13-27(5)17-31(9)23-41-37(45)21-35(39(47)43-25-33(11)19-29(7)15-3)36(40(48)44-26-34(12)20-30(8)16-4)22-38(46)42-24-32(10)18-28(6)14-2/h27-36H,13-26H2,1-12H3,(H,41,45)(H,42,46)(H,43,47)(H,44,48) |
| InChIKey | QNWNKIOXWOVTAR-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.09 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |