C12H20N2O4 — CID 88545478
tert-butyl (2S,4S)-4-cyano-2-(methylperoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 88545478) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-cyano-2-(methylperoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-cyano-2-(methylperoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88545478 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | tert-butyl (2S,4S)-4-cyano-2-(methylperoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | COOC[C@@H]1C[C@H](C#N)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-12(2,3)18-11(15)14-7-9(6-13)5-10(14)8-17-16-4/h9-10H,5,7-8H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | DFRDBEOFQNAKCH-ZJUUUORDSA-N |
| XLogP | 1.71 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|