C27H22F3N3O8 — CID 88549322
2-[(3S)-6-[[(3S)-7-(5-methoxy-2-nitroanilino)-2,3-dihydro-1-benzofuran-3-yl]-(2,2,2-trifluoroacetyl)amino]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 88549322) has the molecular formula C27H22F3N3O8 and a molecular weight of 573.48 g/mol. Its IUPAC name is 2-[(3S)-6-[[(3S)-7-(5-methoxy-2-nitroanilino)-2,3-dihydro-1-benzofuran-3-yl]-(2,2,2-trifluoroacetyl)amino]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[(3S)-6-[[(3S)-7-(5-methoxy-2-nitroanilino)-2,3-dihydro-1-benzofuran-3-yl]-(2,2,2-trifluoroacetyl)amino]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 88549322 |
| Molecular Formula | C27H22F3N3O8 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | 2-[(3S)-6-[[(3S)-7-(5-methoxy-2-nitroanilino)-2,3-dihydro-1-benzofuran-3-yl]-(2,2,2-trifluoroacetyl)amino]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | COc1ccc([N+](=O)[O-])c(Nc2cccc3c2OC[C@H]3N(C(=O)C(F)(F)F)c2ccc3c(c2)OC[C@H]3CC(=O)O)c1 |
| InChI | InChI=1S/C27H22F3N3O8/c1-39-16-6-8-21(33(37)38)20(11-16)31-19-4-2-3-18-22(13-41-25(18)19)32(26(36)27(28,29)30)15-5-7-17-14(9-24(34)35)12-40-23(17)10-15/h2-8,10-11,14,22,31H,9,12-13H2,1H3,(H,34,35)/t14-,22-/m1/s1 |
| InChIKey | VFMPKYUYIXURBE-JLCFBVMHSA-N |
| XLogP | 5.33 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|