C12H21NO3 — CID 88552945
methyl (Z)-4-(3,3-dimethylbutylamino)-2-methyl-4-oxobut-2-enoate (PubChem CID 88552945) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is methyl (Z)-4-(3,3-dimethylbutylamino)-2-methyl-4-oxobut-2-enoate.
| Compound Name | methyl (Z)-4-(3,3-dimethylbutylamino)-2-methyl-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 88552945 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | methyl (Z)-4-(3,3-dimethylbutylamino)-2-methyl-4-oxobut-2-enoate |
| SMILES | COC(=O)/C(C)=C\C(=O)NCCC(C)(C)C |
| InChI | InChI=1S/C12H21NO3/c1-9(11(15)16-5)8-10(14)13-7-6-12(2,3)4/h8H,6-7H2,1-5H3,(H,13,14)/b9-8- |
| InChIKey | ZVPGQVCYRNGRTB-HJWRWDBZSA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|