C25H19ClN2 — CID 88556442
2-chloro-4-[3-(9,9-dimethylfluoren-2-yl)phenyl]pyrimidine (PubChem CID 88556442) has the molecular formula C25H19ClN2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 2-chloro-4-[3-(9,9-dimethylfluoren-2-yl)phenyl]pyrimidine.
| Compound Name | 2-chloro-4-[3-(9,9-dimethylfluoren-2-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 88556442 |
| Molecular Formula | C25H19ClN2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-chloro-4-[3-(9,9-dimethylfluoren-2-yl)phenyl]pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cccc(-c4ccnc(Cl)n4)c3)cc21 |
| InChI | InChI=1S/C25H19ClN2/c1-25(2)21-9-4-3-8-19(21)20-11-10-17(15-22(20)25)16-6-5-7-18(14-16)23-12-13-27-24(26)28-23/h3-15H,1-2H3 |
| InChIKey | SJAMSUCDGMZEFD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |