C14H28N2O2S2 — CID 88559042
N-[2-[[3-(tert-butylamino)-3-oxopropyl]disulfanyl]ethyl]-2,2-dimethylpropanamide (PubChem CID 88559042) has the molecular formula C14H28N2O2S2 and a molecular weight of 320.52 g/mol. Its IUPAC name is N-[2-[[3-(tert-butylamino)-3-oxopropyl]disulfanyl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[3-(tert-butylamino)-3-oxopropyl]disulfanyl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 88559042 |
| Molecular Formula | C14H28N2O2S2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-[2-[[3-(tert-butylamino)-3-oxopropyl]disulfanyl]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)NC(=O)CCSSCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O2S2/c1-13(2,3)12(18)15-8-10-20-19-9-7-11(17)16-14(4,5)6/h7-10H2,1-6H3,(H,15,18)(H,16,17) |
| InChIKey | FYLMIQVHSXPAHI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|