C17H25NO2S — CID 88560917
6-(2,3,3-trimethylindol-5-yl)peroxyhexane-1-thiol (PubChem CID 88560917) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is 6-(2,3,3-trimethylindol-5-yl)peroxyhexane-1-thiol.
| Compound Name | 6-(2,3,3-trimethylindol-5-yl)peroxyhexane-1-thiol |
|---|---|
| PubChem CID | 88560917 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 6-(2,3,3-trimethylindol-5-yl)peroxyhexane-1-thiol |
| SMILES | CC1=Nc2ccc(OOCCCCCCS)cc2C1(C)C |
| InChI | InChI=1S/C17H25NO2S/c1-13-17(2,3)15-12-14(8-9-16(15)18-13)20-19-10-6-4-5-7-11-21/h8-9,12,21H,4-7,10-11H2,1-3H3 |
| InChIKey | WDCBTRUQQYZPKH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|