C19H20N3O+ — CID 8856143
N-(3,5-dimethylphenyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide (PubChem CID 8856143) has the molecular formula C19H20N3O+ and a molecular weight of 306.39 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8856143 |
| Molecular Formula | C19H20N3O+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide |
| SMILES | C=Cn1c[n+](CC(=O)Nc2cc(C)cc(C)c2)c2ccccc21 |
| InChI | InChI=1S/C19H19N3O/c1-4-21-13-22(18-8-6-5-7-17(18)21)12-19(23)20-16-10-14(2)9-15(3)11-16/h4-11,13H,1,12H2,2-3H3/p+1 |
| InChIKey | BACFNACTLGUXFF-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|