C17H13Cl3N3O+ — CID 8856117
2-(3-ethenylbenzimidazol-1-ium-1-yl)-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 8856117) has the molecular formula C17H13Cl3N3O+ and a molecular weight of 381.67 g/mol. Its IUPAC name is 2-(3-ethenylbenzimidazol-1-ium-1-yl)-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-(3-ethenylbenzimidazol-1-ium-1-yl)-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 8856117 |
| Molecular Formula | C17H13Cl3N3O+ |
| Molecular Weight | 381.67 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 2-(3-ethenylbenzimidazol-1-ium-1-yl)-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | C=Cn1c[n+](CC(=O)Nc2c(Cl)cc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C17H12Cl3N3O/c1-2-22-10-23(15-6-4-3-5-14(15)22)9-16(24)21-17-12(19)7-11(18)8-13(17)20/h2-8,10H,1,9H2/p+1 |
| InChIKey | RCGHSDHLTXZBMS-UHFFFAOYSA-O |
| XLogP | 4.63 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.67 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|