C31H32N4O5 — CID 88561567
methyl 9-(benzhydrylideneamino)-3-butoxy-7-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate (PubChem CID 88561567) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is methyl 9-(benzhydrylideneamino)-3-butoxy-7-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate.
| Compound Name | methyl 9-(benzhydrylideneamino)-3-butoxy-7-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 88561567 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | methyl 9-(benzhydrylideneamino)-3-butoxy-7-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidine-2-carboxylate |
| SMILES | CCCCOc1c(C(=O)OC)nc2c(N=C(c3ccccc3)c3ccccc3)cc(N3CCOCC3)cn2c1=O |
| InChI | InChI=1S/C31H32N4O5/c1-3-4-17-40-28-27(31(37)38-2)33-29-25(20-24(21-35(29)30(28)36)34-15-18-39-19-16-34)32-26(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-14,20-21H,3-4,15-19H2,1-2H3 |
| InChIKey | CJPLHUWCNFOLLF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 94.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|