C26H29FN4O5 — CID 70794623
3-butoxy-N-[3-(4-fluorophenyl)-2-oxopropyl]-7-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidine-2-carboxamide (PubChem CID 70794623) has the molecular formula C26H29FN4O5 and a molecular weight of 496.54 g/mol. Its IUPAC name is 3-butoxy-N-[3-(4-fluorophenyl)-2-oxopropyl]-7-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidine-2-carboxamide.
| Compound Name | 3-butoxy-N-[3-(4-fluorophenyl)-2-oxopropyl]-7-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 70794623 |
| Molecular Formula | C26H29FN4O5 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 3-butoxy-N-[3-(4-fluorophenyl)-2-oxopropyl]-7-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidine-2-carboxamide |
| SMILES | CCCCOc1c(C(=O)NCC(=O)Cc2ccc(F)cc2)nc2ccc(N3CCOCC3)cn2c1=O |
| InChI | InChI=1S/C26H29FN4O5/c1-2-3-12-36-24-23(25(33)28-16-21(32)15-18-4-6-19(27)7-5-18)29-22-9-8-20(17-31(22)26(24)34)30-10-13-35-14-11-30/h4-9,17H,2-3,10-16H2,1H3,(H,28,33) |
| InChIKey | WOMRTEVDJITTIT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|