C14H27NO2S — CID 88561748
N,N-bis(prop-2-enyl)octane-1-sulfonamide (PubChem CID 88561748) has the molecular formula C14H27NO2S and a molecular weight of 273.44 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)octane-1-sulfonamide.
| Compound Name | N,N-bis(prop-2-enyl)octane-1-sulfonamide |
|---|---|
| PubChem CID | 88561748 |
| Molecular Formula | C14H27NO2S |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N,N-bis(prop-2-enyl)octane-1-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)CCCCCCCC |
| InChI | InChI=1S/C14H27NO2S/c1-4-7-8-9-10-11-14-18(16,17)15(12-5-2)13-6-3/h5-6H,2-4,7-14H2,1H3 |
| InChIKey | KHYXAOITPAHXHS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|