C34H38P2+2 — CID 88564218
2-methylprop-2-enyl-[2-[2-methylprop-2-enyl(diphenyl)phosphaniumyl]ethyl]-diphenylphosphanium (PubChem CID 88564218) has the molecular formula C34H38P2+2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 2-methylprop-2-enyl-[2-[2-methylprop-2-enyl(diphenyl)phosphaniumyl]ethyl]-diphenylphosphanium.
| Compound Name | 2-methylprop-2-enyl-[2-[2-methylprop-2-enyl(diphenyl)phosphaniumyl]ethyl]-diphenylphosphanium |
|---|---|
| PubChem CID | 88564218 |
| Molecular Formula | C34H38P2+2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-methylprop-2-enyl-[2-[2-methylprop-2-enyl(diphenyl)phosphaniumyl]ethyl]-diphenylphosphanium |
| SMILES | C=C(C)C[P+](CC[P+](CC(=C)C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38P2/c1-29(2)27-35(31-17-9-5-10-18-31,32-19-11-6-12-20-32)25-26-36(28-30(3)4,33-21-13-7-14-22-33)34-23-15-8-16-24-34/h5-24H,1,3,25-28H2,2,4H3/q+2 |
| InChIKey | FQRHFHDOGWKMOL-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|