C19H12F6O2S — CID 88565465
7-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2H-thiochromene-3-carbaldehyde (PubChem CID 88565465) has the molecular formula C19H12F6O2S and a molecular weight of 418.36 g/mol. Its IUPAC name is 7-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2H-thiochromene-3-carbaldehyde.
| Compound Name | 7-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2H-thiochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 88565465 |
| Molecular Formula | C19H12F6O2S |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 7-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2H-thiochromene-3-carbaldehyde |
| SMILES | O=CC1=Cc2ccc(OCc3ccc(C(F)(F)F)cc3C(F)(F)F)cc2SC1 |
| InChI | InChI=1S/C19H12F6O2S/c20-18(21,22)14-3-1-13(16(6-14)19(23,24)25)9-27-15-4-2-12-5-11(8-26)10-28-17(12)7-15/h1-8H,9-10H2 |
| InChIKey | SFIVBNKWNJMMFG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|