C20H17F6N7O2S — CID 88569790
2-[5-[2-[2-[2,5-bis(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-thiazol-5-yl]tetrazol-2-yl]acetic acid (PubChem CID 88569790) has the molecular formula C20H17F6N7O2S and a molecular weight of 533.46 g/mol. Its IUPAC name is 2-[5-[2-[2-[2,5-bis(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-thiazol-5-yl]tetrazol-2-yl]acetic acid.
| Compound Name | 2-[5-[2-[2-[2,5-bis(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-thiazol-5-yl]tetrazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 88569790 |
| Molecular Formula | C20H17F6N7O2S |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 2-[5-[2-[2-[2,5-bis(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-thiazol-5-yl]tetrazol-2-yl]acetic acid |
| SMILES | O=C(O)Cn1nnc(-c2cnc(N3CC4CN(c5cc(C(F)(F)F)ccc5C(F)(F)F)CC4C3)s2)n1 |
| InChI | InChI=1S/C20H17F6N7O2S/c21-19(22,23)12-1-2-13(20(24,25)26)14(3-12)31-5-10-7-32(8-11(10)6-31)18-27-4-15(36-18)17-28-30-33(29-17)9-16(34)35/h1-4,10-11H,5-9H2,(H,34,35) |
| InChIKey | YJTQSSXUYYBWCR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |