C19H17ClF3N7O2S — CID 58043000
2-[5-[2-[2-[2-chloro-5-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-thiazol-5-yl]tetrazol-2-yl]acetic acid (PubChem CID 58043000) has the molecular formula C19H17ClF3N7O2S and a molecular weight of 499.91 g/mol. Its IUPAC name is 2-[5-[2-[2-[2-chloro-5-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-thiazol-5-yl]tetrazol-2-yl]acetic acid.
| Compound Name | 2-[5-[2-[2-[2-chloro-5-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-thiazol-5-yl]tetrazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 58043000 |
| Molecular Formula | C19H17ClF3N7O2S |
| Molecular Weight | 499.91 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 2-[5-[2-[2-[2-chloro-5-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-thiazol-5-yl]tetrazol-2-yl]acetic acid |
| SMILES | O=C(O)Cn1nnc(-c2cnc(N3CC4CN(c5cc(C(F)(F)F)ccc5Cl)CC4C3)s2)n1 |
| InChI | InChI=1S/C19H17ClF3N7O2S/c20-13-2-1-12(19(21,22)23)3-14(13)28-5-10-7-29(8-11(10)6-28)18-24-4-15(33-18)17-25-27-30(26-17)9-16(31)32/h1-4,10-11H,5-9H2,(H,31,32) |
| InChIKey | DONMCCWEXJFPPI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.91 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |