C18H20ClFN8S — CID 58042968
2-[2-(2-chloro-5-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(2-propyltetrazol-5-yl)-1,3,4-thiadiazole (PubChem CID 58042968) has the molecular formula C18H20ClFN8S and a molecular weight of 434.93 g/mol. Its IUPAC name is 2-[2-(2-chloro-5-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(2-propyltetrazol-5-yl)-1,3,4-thiadiazole.
| Compound Name | 2-[2-(2-chloro-5-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(2-propyltetrazol-5-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58042968 |
| Molecular Formula | C18H20ClFN8S |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[2-(2-chloro-5-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(2-propyltetrazol-5-yl)-1,3,4-thiadiazole |
| SMILES | CCCn1nnc(-c2nnc(N3CC4CN(c5cc(F)ccc5Cl)CC4C3)s2)n1 |
| InChI | InChI=1S/C18H20ClFN8S/c1-2-5-28-24-16(21-25-28)17-22-23-18(29-17)27-9-11-7-26(8-12(11)10-27)15-6-13(20)3-4-14(15)19/h3-4,6,11-12H,2,5,7-10H2,1H3 |
| InChIKey | OAACNDKLUSUQFR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |