C17H15Cl2N7S — CID 58042910
CID 58042910 (PubChem CID 58042910) has the molecular formula C17H15Cl2N7S and a molecular weight of 420.33 g/mol.
| Compound Name | CID 58042910 |
|---|---|
| PubChem CID | 58042910 |
| Molecular Formula | C17H15Cl2N7S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | — |
| SMILES | [CH]n1nnc(-c2cnc(N3CC4CN(c5cc(Cl)ccc5Cl)CC4C3)s2)n1 |
| InChI | InChI=1S/C17H15Cl2N7S/c1-24-22-16(21-23-24)15-5-20-17(27-15)26-8-10-6-25(7-11(10)9-26)14-4-12(18)2-3-13(14)19/h1-5,10-11H,6-9H2 |
| InChIKey | PRPUTADHDCSEQM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |