C16H14ClFN4O — CID 58042915
3-[2-(2-chloro-5-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-isocyano-1,2-oxazole (PubChem CID 58042915) has the molecular formula C16H14ClFN4O and a molecular weight of 332.77 g/mol. Its IUPAC name is 3-[2-(2-chloro-5-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-isocyano-1,2-oxazole.
| Compound Name | 3-[2-(2-chloro-5-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-isocyano-1,2-oxazole |
|---|---|
| PubChem CID | 58042915 |
| Molecular Formula | C16H14ClFN4O |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-[2-(2-chloro-5-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-isocyano-1,2-oxazole |
| SMILES | [C-]#[N+]c1cc(N2CC3CN(c4cc(F)ccc4Cl)CC3C2)no1 |
| InChI | InChI=1S/C16H14ClFN4O/c1-19-16-5-15(20-23-16)22-8-10-6-21(7-11(10)9-22)14-4-12(18)2-3-13(14)17/h2-5,10-11H,6-9H2 |
| InChIKey | MZIAXDSFGSKZKS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|