C11H12ClFN2 — CID 58042937
2-(2-chloro-5-fluorophenyl)-2,6-diazaspiro[3.3]heptane (PubChem CID 58042937) has the molecular formula C11H12ClFN2 and a molecular weight of 226.68 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenyl)-2,6-diazaspiro[3.3]heptane.
| Compound Name | 2-(2-chloro-5-fluorophenyl)-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 58042937 |
| Molecular Formula | C11H12ClFN2 |
| Molecular Weight | 226.68 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(2-chloro-5-fluorophenyl)-2,6-diazaspiro[3.3]heptane |
| SMILES | Fc1ccc(Cl)c(N2CC3(CNC3)C2)c1 |
| InChI | InChI=1S/C11H12ClFN2/c12-9-2-1-8(13)3-10(9)15-6-11(7-15)4-14-5-11/h1-3,14H,4-7H2 |
| InChIKey | SBMXOGVSFIMMNY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.68 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |