C23H20N4O3 — CID 88569991
5-[3-[1-(3-oxopropyl)indol-5-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile (PubChem CID 88569991) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 5-[3-[1-(3-oxopropyl)indol-5-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[3-[1-(3-oxopropyl)indol-5-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 88569991 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 5-[3-[1-(3-oxopropyl)indol-5-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3ccc4c(ccn4CCC=O)c3)no2)cc1C#N |
| InChI | InChI=1S/C23H20N4O3/c1-15(2)29-21-7-5-18(13-19(21)14-24)23-25-22(26-30-23)17-4-6-20-16(12-17)8-10-27(20)9-3-11-28/h4-8,10-13,15H,3,9H2,1-2H3 |
| InChIKey | MRKKNYCNWBJALZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 93.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|