C22H20N6O3 — CID 89137853
5-[3-[1-(4-oxobutyl)indazol-5-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxypyridine-3-carbonitrile (PubChem CID 89137853) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is 5-[3-[1-(4-oxobutyl)indazol-5-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxypyridine-3-carbonitrile.
| Compound Name | 5-[3-[1-(4-oxobutyl)indazol-5-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 89137853 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5-[3-[1-(4-oxobutyl)indazol-5-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxypyridine-3-carbonitrile |
| SMILES | CC(C)Oc1ncc(-c2nc(-c3ccc4c(cnn4CCCC=O)c3)no2)cc1C#N |
| InChI | InChI=1S/C22H20N6O3/c1-14(2)30-21-16(11-23)10-18(12-24-21)22-26-20(27-31-22)15-5-6-19-17(9-15)13-25-28(19)7-3-4-8-29/h5-6,8-10,12-14H,3-4,7H2,1-2H3 |
| InChIKey | GVUAKBGMBWHUKM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 119.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|