C25H27N5O4 — CID 147980741
ethyl 4-[5-[5-(3-methanimidoyl-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]butanoate (PubChem CID 147980741) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is ethyl 4-[5-[5-(3-methanimidoyl-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]butanoate.
| Compound Name | ethyl 4-[5-[5-(3-methanimidoyl-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]butanoate |
|---|---|
| PubChem CID | 147980741 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | ethyl 4-[5-[5-(3-methanimidoyl-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]butanoate |
| SMILES | [H]/N=C/c1cc(-c2nc(-c3ccc4c(cnn4CCCC(=O)OCC)c3)no2)ccc1OC(C)C |
| InChI | InChI=1S/C25H27N5O4/c1-4-32-23(31)6-5-11-30-21-9-7-17(12-20(21)15-27-30)24-28-25(34-29-24)18-8-10-22(33-16(2)3)19(13-18)14-26/h7-10,12-16,26H,4-6,11H2,1-3H3/b26-14+ |
| InChIKey | ITEBXJWOPXVHMV-VULFUBBASA-N |
| XLogP | 4.88 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|