C23H20N5NaO4 — CID 158453030
sodium 3-[5-[5-[4-[(2R)-butan-2-yl]oxy-3-isocyanophenyl]-1,2,4-oxadiazol-3-yl]indazol-1-yl]propanoate (PubChem CID 158453030) has the molecular formula C23H20N5NaO4 and a molecular weight of 453.43 g/mol. Its IUPAC name is sodium 3-[5-[5-[4-[(2R)-butan-2-yl]oxy-3-isocyanophenyl]-1,2,4-oxadiazol-3-yl]indazol-1-yl]propanoate.
| Compound Name | sodium 3-[5-[5-[4-[(2R)-butan-2-yl]oxy-3-isocyanophenyl]-1,2,4-oxadiazol-3-yl]indazol-1-yl]propanoate |
|---|---|
| PubChem CID | 158453030 |
| Molecular Formula | C23H20N5NaO4 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | sodium 3-[5-[5-[4-[(2R)-butan-2-yl]oxy-3-isocyanophenyl]-1,2,4-oxadiazol-3-yl]indazol-1-yl]propanoate |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3ccc4c(cnn4CCC(=O)[O-])c3)no2)ccc1O[C@H](C)CC.[Na+] |
| InChI | InChI=1S/C23H21N5O4.Na/c1-4-14(2)31-20-8-6-16(12-18(20)24-3)23-26-22(27-32-23)15-5-7-19-17(11-15)13-25-28(19)10-9-21(29)30;/h5-8,11-14H,4,9-10H2,1-2H3,(H,29,30);/q;+1/p-1/t14-;/m1./s1 |
| InChIKey | BESFUYWGZITHTJ-PFEQFJNWSA-M |
| XLogP | 0.63 |
| TPSA | 110.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|