C21H19ClN4O5 — CID 87517481
ethyl 3-[5-[5-(3-chloro-4-methylperoxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]propanoate (PubChem CID 87517481) has the molecular formula C21H19ClN4O5 and a molecular weight of 442.86 g/mol. Its IUPAC name is ethyl 3-[5-[5-(3-chloro-4-methylperoxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]propanoate.
| Compound Name | ethyl 3-[5-[5-(3-chloro-4-methylperoxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]propanoate |
|---|---|
| PubChem CID | 87517481 |
| Molecular Formula | C21H19ClN4O5 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | ethyl 3-[5-[5-(3-chloro-4-methylperoxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]propanoate |
| SMILES | CCOC(=O)CCn1ncc2cc(-c3noc(-c4ccc(OOC)c(Cl)c4)n3)ccc21 |
| InChI | InChI=1S/C21H19ClN4O5/c1-3-29-19(27)8-9-26-17-6-4-13(10-15(17)12-23-26)20-24-21(30-25-20)14-5-7-18(31-28-2)16(22)11-14/h4-7,10-12H,3,8-9H2,1-2H3 |
| InChIKey | FIRUKNDSVHQKFY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 101.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|