C24H24F2O7S — CID 88570322
1,1-difluoro-2-[(3-naphthalen-1-yloxycarbonyl-1-adamantyl)methoxy]-2-oxoethanesulfonic acid (PubChem CID 88570322) has the molecular formula C24H24F2O7S and a molecular weight of 494.51 g/mol. Its IUPAC name is 1,1-difluoro-2-[(3-naphthalen-1-yloxycarbonyl-1-adamantyl)methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(3-naphthalen-1-yloxycarbonyl-1-adamantyl)methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88570322 |
| Molecular Formula | C24H24F2O7S |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 1,1-difluoro-2-[(3-naphthalen-1-yloxycarbonyl-1-adamantyl)methoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(Oc1cccc2ccccc12)C12CC3CC(CC(COC(=O)C(F)(F)S(=O)(=O)O)(C3)C1)C2 |
| InChI | InChI=1S/C24H24F2O7S/c25-24(26,34(29,30)31)21(28)32-14-22-9-15-8-16(10-22)12-23(11-15,13-22)20(27)33-19-7-3-5-17-4-1-2-6-18(17)19/h1-7,15-16H,8-14H2,(H,29,30,31) |
| InChIKey | CTMREOGHZHIAMP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|