C21H22B2FN4O6 — CID 88571695
CID 88571695 (PubChem CID 88571695) has the molecular formula C21H22B2FN4O6 and a molecular weight of 467.05 g/mol.
| Compound Name | CID 88571695 |
|---|---|
| PubChem CID | 88571695 |
| Molecular Formula | C21H22B2FN4O6 |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCN(c2c(F)cc3c(=O)c(C(=O)OC)cn(C4CC4)c3c2OC)CCN1[B]C=O |
| InChI | InChI=1S/C21H22B2FN4O6/c1-33-19-16-13(18(30)14(20(31)34-2)10-26(16)12-3-4-12)9-15(24)17(19)25-5-7-27(21(22)32)28(8-6-25)23-11-29/h9-12H,3-8H2,1-2H3 |
| InChIKey | XYIHKFSKMGBTRP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|