C26H25ClIN3O5S — CID 88571906
5-chloro-2-(4-iodobenzoyl)-7-methyl-N-[1-(3-methylsulfonylpyrrol-1-yl)-3-oxopropan-2-yl]-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 88571906) has the molecular formula C26H25ClIN3O5S and a molecular weight of 653.93 g/mol. Its IUPAC name is 5-chloro-2-(4-iodobenzoyl)-7-methyl-N-[1-(3-methylsulfonylpyrrol-1-yl)-3-oxopropan-2-yl]-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | 5-chloro-2-(4-iodobenzoyl)-7-methyl-N-[1-(3-methylsulfonylpyrrol-1-yl)-3-oxopropan-2-yl]-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 88571906 |
| Molecular Formula | C26H25ClIN3O5S |
| Molecular Weight | 653.93 g/mol |
| Exact Mass | 653.02 |
| IUPAC Name | 5-chloro-2-(4-iodobenzoyl)-7-methyl-N-[1-(3-methylsulfonylpyrrol-1-yl)-3-oxopropan-2-yl]-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | Cc1cc2c(c(Cl)c1C(=O)NC(C=O)Cn1ccc(S(C)(=O)=O)c1)CCN(C(=O)c1ccc(I)cc1)C2 |
| InChI | InChI=1S/C26H25ClIN3O5S/c1-16-11-18-12-31(26(34)17-3-5-19(28)6-4-17)10-8-22(18)24(27)23(16)25(33)29-20(15-32)13-30-9-7-21(14-30)37(2,35)36/h3-7,9,11,14-15,20H,8,10,12-13H2,1-2H3,(H,29,33) |
| InChIKey | MCCXYMLJZVOGMN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.93 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|