About CID 88572243
CID 88572243 (PubChem CID 88572243) has the molecular formula C7H13BO2S
and a molecular weight of 172.06 g/mol.
Molecular Properties
| Compound Name | CID 88572243 |
| PubChem CID | 88572243 |
| Molecular Formula | C7H13BO2S |
| Molecular Weight | 172.06 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](C)[C@@](CO)(CS)O1 |
| InChI | InChI=1S/C7H13BO2S/c1-5-2-6(8)10-7(5,3-9)4-11/h5-6,9,11H,2-4H2,1H3/t5-,6-,7-/m1/s1 |
| InChIKey | UQIVRTZZCVYMBU-FSDSQADBSA-N |
| XLogP | 0.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.06 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 88572243 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88572243?
The IUPAC name of CID 88572243 (CID 88572243) is not available.
What is the SMILES notation for CID 88572243?
The canonical SMILES for CID 88572243 is [B][C@H]1C[C@@H](C)[C@@](CO)(CS)O1.
What is the InChIKey of CID 88572243?
The InChIKey is UQIVRTZZCVYMBU-FSDSQADBSA-N. The full InChI is InChI=1S/C7H13BO2S/c1-5-2-6(8)10-7(5,3-9)4-11/h5-6,9,11H,2-4H2,1H3/t5-,6-,7-/m1/s1.
What are the key properties of CID 88572243?
CID 88572243 has a molecular weight of 172.06 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88572243 is sourced from PubChem (CID 88572243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).