C22H18F6N8O — CID 88574102
1-[3-[7-[(Z)-1-amino-3-(3-cyano-1,1,1-trifluoropropan-2-yl)iminoprop-1-en-2-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 88574102) has the molecular formula C22H18F6N8O and a molecular weight of 524.43 g/mol. Its IUPAC name is 1-[3-[7-[(Z)-1-amino-3-(3-cyano-1,1,1-trifluoropropan-2-yl)iminoprop-1-en-2-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-[(Z)-1-amino-3-(3-cyano-1,1,1-trifluoropropan-2-yl)iminoprop-1-en-2-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 88574102 |
| Molecular Formula | C22H18F6N8O |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 1-[3-[7-[(Z)-1-amino-3-(3-cyano-1,1,1-trifluoropropan-2-yl)iminoprop-1-en-2-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | N#CCC(/N=C/C(=C\N)c1cnn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1)C(F)(F)F |
| InChI | InChI=1S/C22H18F6N8O/c23-21(24,25)12-33-20(37)35-16-3-1-2-13(6-16)17-11-32-19-7-14(10-34-36(17)19)15(8-30)9-31-18(4-5-29)22(26,27)28/h1-3,6-11,18H,4,12,30H2,(H2,33,35,37)/b15-8+,31-9+ |
| InChIKey | KWRVEOVZCVRTMK-YBHYMNNNSA-N |
| XLogP | 4.30 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|