C27H23NS — CID 88574117
3-[[5-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-1-benzothiophen-2-yl]methyl]-9H-carbazole (PubChem CID 88574117) has the molecular formula C27H23NS and a molecular weight of 393.56 g/mol. Its IUPAC name is 3-[[5-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-1-benzothiophen-2-yl]methyl]-9H-carbazole.
| Compound Name | 3-[[5-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-1-benzothiophen-2-yl]methyl]-9H-carbazole |
|---|---|
| PubChem CID | 88574117 |
| Molecular Formula | C27H23NS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-[[5-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-1-benzothiophen-2-yl]methyl]-9H-carbazole |
| SMILES | C=C/C(C)=C\c1c(Cc2ccc3[nH]c4ccccc4c3c2)sc2ccc(C)cc12 |
| InChI | InChI=1S/C27H23NS/c1-4-17(2)13-23-22-14-18(3)9-12-26(22)29-27(23)16-19-10-11-25-21(15-19)20-7-5-6-8-24(20)28-25/h4-15,28H,1,16H2,2-3H3/b17-13- |
| InChIKey | UJLNVZYLKSMSGP-LGMDPLHJSA-N |
| XLogP | 8.02 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|