C9H9F3N2 — CID 88574207
2-[(3Z)-penta-1,3-dien-2-yl]-5-(trifluoromethyl)-1H-imidazole (PubChem CID 88574207) has the molecular formula C9H9F3N2 and a molecular weight of 202.18 g/mol. Its IUPAC name is 2-[(3Z)-penta-1,3-dien-2-yl]-5-(trifluoromethyl)-1H-imidazole.
| Compound Name | 2-[(3Z)-penta-1,3-dien-2-yl]-5-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 88574207 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-[(3Z)-penta-1,3-dien-2-yl]-5-(trifluoromethyl)-1H-imidazole |
| SMILES | C=C(/C=C\C)c1ncc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C9H9F3N2/c1-3-4-6(2)8-13-5-7(14-8)9(10,11)12/h3-5H,2H2,1H3,(H,13,14)/b4-3- |
| InChIKey | UUWKYNVNBQVXIM-ARJAWSKDSA-N |
| XLogP | 3.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|