C17H16F7NO3 — CID 88575293
cyclopentyl [4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl] carbonate (PubChem CID 88575293) has the molecular formula C17H16F7NO3 and a molecular weight of 415.31 g/mol. Its IUPAC name is cyclopentyl [4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl] carbonate.
| Compound Name | cyclopentyl [4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 88575293 |
| Molecular Formula | C17H16F7NO3 |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | cyclopentyl [4-[C-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylcarbonimidoyl]phenyl] carbonate |
| SMILES | C/N=C(\c1ccc(OC(=O)OC2CCCC2)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H16F7NO3/c1-25-13(15(18,19)16(20,21)17(22,23)24)10-6-8-12(9-7-10)28-14(26)27-11-4-2-3-5-11/h6-9,11H,2-5H2,1H3/b25-13+ |
| InChIKey | MCJRGPHUDVDNTB-DHRITJCHSA-N |
| XLogP | 5.40 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|