C20H26N2O6S2 — CID 88576547
2-[2-[2-(4-methylsulfonylphenoxy)octanoylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 88576547) has the molecular formula C20H26N2O6S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[2-[2-(4-methylsulfonylphenoxy)octanoylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(4-methylsulfonylphenoxy)octanoylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 88576547 |
| Molecular Formula | C20H26N2O6S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-[2-[2-(4-methylsulfonylphenoxy)octanoylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCCCCCC(Oc1ccc(S(C)(=O)=O)cc1)C(=O)Nc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C20H26N2O6S2/c1-3-4-5-6-7-17(28-15-8-10-16(11-9-15)30(2,26)27)19(25)22-20-21-14(13-29-20)12-18(23)24/h8-11,13,17H,3-7,12H2,1-2H3,(H,23,24)(H,21,22,25) |
| InChIKey | XTKDMBOINJPECI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|