C12H22INO3 — CID 88577439
tert-butyl N-[(2S)-1-hydroxybut-3-en-2-yl]-N-[(1S)-1-iodopropyl]carbamate (PubChem CID 88577439) has the molecular formula C12H22INO3 and a molecular weight of 355.22 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-hydroxybut-3-en-2-yl]-N-[(1S)-1-iodopropyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-hydroxybut-3-en-2-yl]-N-[(1S)-1-iodopropyl]carbamate |
|---|---|
| PubChem CID | 88577439 |
| Molecular Formula | C12H22INO3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | tert-butyl N-[(2S)-1-hydroxybut-3-en-2-yl]-N-[(1S)-1-iodopropyl]carbamate |
| SMILES | C=C[C@@H](CO)N(C(=O)OC(C)(C)C)[C@@H](I)CC |
| InChI | InChI=1S/C12H22INO3/c1-6-9(8-15)14(10(13)7-2)11(16)17-12(3,4)5/h6,9-10,15H,1,7-8H2,2-5H3/t9-,10+/m0/s1 |
| InChIKey | UMQYDLZZSLDYJD-VHSXEESVSA-N |
| XLogP | 2.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|