C24H24N2O5S — CID 88580429
[2-[[4-(sulfanylmethyl)phenyl]carbamoyl]phenyl] N-[(2,4-dimethoxyphenyl)methyl]carbamate (PubChem CID 88580429) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is [2-[[4-(sulfanylmethyl)phenyl]carbamoyl]phenyl] N-[(2,4-dimethoxyphenyl)methyl]carbamate.
| Compound Name | [2-[[4-(sulfanylmethyl)phenyl]carbamoyl]phenyl] N-[(2,4-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 88580429 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [2-[[4-(sulfanylmethyl)phenyl]carbamoyl]phenyl] N-[(2,4-dimethoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CNC(=O)Oc2ccccc2C(=O)Nc2ccc(CS)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H24N2O5S/c1-29-19-12-9-17(22(13-19)30-2)14-25-24(28)31-21-6-4-3-5-20(21)23(27)26-18-10-7-16(15-32)8-11-18/h3-13,32H,14-15H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | STMDIFQRMWYUGS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|