C7H11N — CID 88581069
(2Z,4Z)-3-methylhexa-2,4-dien-1-imine (PubChem CID 88581069) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is (2Z,4Z)-3-methylhexa-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-3-methylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 88581069 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | (2Z,4Z)-3-methylhexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(C)\C=C/C |
| InChI | InChI=1S/C7H11N/c1-3-4-7(2)5-6-8/h3-6,8H,1-2H3/b4-3-,7-5-,8-6+ |
| InChIKey | FZHOJZCJXQXIOR-XSCRVUOGSA-N |
| XLogP | 2.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|