C25H26N2O2 — CID 88581480
3-[4-[[4-(N-ethyl-C-phenylcarbonimidoyl)phenyl]methylamino]phenyl]propanoic acid (PubChem CID 88581480) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-[4-[[4-(N-ethyl-C-phenylcarbonimidoyl)phenyl]methylamino]phenyl]propanoic acid.
| Compound Name | 3-[4-[[4-(N-ethyl-C-phenylcarbonimidoyl)phenyl]methylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 88581480 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-[4-[[4-(N-ethyl-C-phenylcarbonimidoyl)phenyl]methylamino]phenyl]propanoic acid |
| SMILES | CC/N=C(\c1ccccc1)c1ccc(CNc2ccc(CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O2/c1-2-26-25(21-6-4-3-5-7-21)22-13-8-20(9-14-22)18-27-23-15-10-19(11-16-23)12-17-24(28)29/h3-11,13-16,27H,2,12,17-18H2,1H3,(H,28,29)/b26-25+ |
| InChIKey | QJBHQRTXEQBNAM-OCEACIFDSA-N |
| XLogP | 5.17 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|