C21H28N2O2 — CID 91109497
3-[4-[[4-[3-(dimethylamino)propyl]anilino]methyl]phenyl]propanoic acid (PubChem CID 91109497) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 3-[4-[[4-[3-(dimethylamino)propyl]anilino]methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[[4-[3-(dimethylamino)propyl]anilino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91109497 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 3-[4-[[4-[3-(dimethylamino)propyl]anilino]methyl]phenyl]propanoic acid |
| SMILES | CN(C)CCCc1ccc(NCc2ccc(CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-23(2)15-3-4-17-9-12-20(13-10-17)22-16-19-7-5-18(6-8-19)11-14-21(24)25/h5-10,12-13,22H,3-4,11,14-16H2,1-2H3,(H,24,25) |
| InChIKey | SJGMBBCTGVLCFV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |