C16H19NO4 — CID 88581482
benzyl 2-formyl-3-(3-oxopropyl)pyrrolidine-1-carboxylate (PubChem CID 88581482) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is benzyl 2-formyl-3-(3-oxopropyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-formyl-3-(3-oxopropyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88581482 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | benzyl 2-formyl-3-(3-oxopropyl)pyrrolidine-1-carboxylate |
| SMILES | O=CCCC1CCN(C(=O)OCc2ccccc2)C1C=O |
| InChI | InChI=1S/C16H19NO4/c18-10-4-7-14-8-9-17(15(14)11-19)16(20)21-12-13-5-2-1-3-6-13/h1-3,5-6,10-11,14-15H,4,7-9,12H2 |
| InChIKey | UANNJZANDXWTJG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|