C22H22N2O2S — CID 8858191
3-(2,3-dimethylphenyl)-2-[(1S)-2-oxocyclohexyl]sulfanylquinazolin-4-one (PubChem CID 8858191) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-2-[(1S)-2-oxocyclohexyl]sulfanylquinazolin-4-one.
| Compound Name | 3-(2,3-dimethylphenyl)-2-[(1S)-2-oxocyclohexyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 8858191 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-2-[(1S)-2-oxocyclohexyl]sulfanylquinazolin-4-one |
| SMILES | Cc1cccc(-n2c(S[C@H]3CCCCC3=O)nc3ccccc3c2=O)c1C |
| InChI | InChI=1S/C22H22N2O2S/c1-14-8-7-11-18(15(14)2)24-21(26)16-9-3-4-10-17(16)23-22(24)27-20-13-6-5-12-19(20)25/h3-4,7-11,20H,5-6,12-13H2,1-2H3/t20-/m0/s1 |
| InChIKey | BVTNAKVAARTJRD-FQEVSTJZSA-N |
| XLogP | 4.61 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |