About CID 88582123
CID 88582123 (PubChem CID 88582123) has the molecular formula C33H21BBrN3
and a molecular weight of 550.27 g/mol.
Molecular Properties
| Compound Name | CID 88582123 |
| PubChem CID | 88582123 |
| Molecular Formula | C33H21BBrN3 |
| Molecular Weight | 550.27 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Br)cc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c1 |
| InChI | InChI=1S/C33H21BBrN3/c34-29-19-28(20-30(35)21-29)33-37-31(26-15-11-24(12-16-26)22-7-3-1-4-8-22)36-32(38-33)27-17-13-25(14-18-27)23-9-5-2-6-10-23/h1-21H |
| InChIKey | QZNUMZGVDDBPKC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.27 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88582123 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88582123?
The IUPAC name of CID 88582123 (CID 88582123) is not available.
What is the SMILES notation for CID 88582123?
The canonical SMILES for CID 88582123 is [B]c1cc(Br)cc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c1.
What is the InChIKey of CID 88582123?
The InChIKey is QZNUMZGVDDBPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H21BBrN3/c34-29-19-28(20-30(35)21-29)33-37-31(26-15-11-24(12-16-26)22-7-3-1-4-8-22)36-32(38-33)27-17-13-25(14-18-27)23-9-5-2-6-10-23/h1-21H.
What are the key properties of CID 88582123?
CID 88582123 has a molecular weight of 550.27 g/mol, XLogP of 7.76, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88582123 is sourced from PubChem (CID 88582123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).